C23H26N6O2 — CID 140649039
5-[(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine (PubChem CID 140649039) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-[(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine.
| Compound Name | 5-[(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 140649039 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 5-[(3-methylphenyl)methylideneamino]-6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
| SMILES | Cc1cccc(/C=N/c2c(N)nc(OCCc3ccccn3)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H26N6O2/c1-17-5-4-6-18(15-17)16-26-20-21(24)27-23(28-22(20)29-10-13-30-14-11-29)31-12-8-19-7-2-3-9-25-19/h2-7,9,15-16H,8,10-14H2,1H3,(H2,24,27,28)/b26-16+ |
| InChIKey | PHYASKKLVWPSOY-WGOQTCKBSA-N |
| XLogP | 2.97 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|