C24H28N6O2 — CID 89163648
1-(3-methylphenyl)-2-[1-[6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]ethenyl]hydrazine (PubChem CID 89163648) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[1-[6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]ethenyl]hydrazine.
| Compound Name | 1-(3-methylphenyl)-2-[1-[6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]ethenyl]hydrazine |
|---|---|
| PubChem CID | 89163648 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-(3-methylphenyl)-2-[1-[6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]ethenyl]hydrazine |
| SMILES | C=C(NNc1cccc(C)c1)c1cc(N2CCOCC2)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C24H28N6O2/c1-18-6-5-8-21(16-18)29-28-19(2)22-17-23(30-11-14-31-15-12-30)27-24(26-22)32-13-9-20-7-3-4-10-25-20/h3-8,10,16-17,28-29H,2,9,11-15H2,1H3 |
| InChIKey | CWNVNBMOVIYUJJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|