C17H25N5O3 — CID 143450374
methanol;N-methyl-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-amine (PubChem CID 143450374) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is methanol;N-methyl-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-amine.
| Compound Name | methanol;N-methyl-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143450374 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | methanol;N-methyl-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-amine |
| SMILES | CNc1nc(OCCc2ccccn2)cc(N2CCOCC2)n1.CO |
| InChI | InChI=1S/C16H21N5O2.CH4O/c1-17-16-19-14(21-7-10-22-11-8-21)12-15(20-16)23-9-5-13-4-2-3-6-18-13;1-2/h2-4,6,12H,5,7-11H2,1H3,(H,17,19,20);2H,1H3 |
| InChIKey | UPUPPZOUODCKEM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |