C23H27N5O2S — CID 58060385
N-[(5-ethylthiophen-2-yl)methyl]-1-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methanimine (PubChem CID 58060385) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-1-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methanimine.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-1-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methanimine |
|---|---|
| PubChem CID | 58060385 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-1-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methanimine |
| SMILES | CCc1ccc(C/N=C/c2nc(OCCc3ccccn3)cc(N3CCOCC3)n2)s1 |
| InChI | InChI=1S/C23H27N5O2S/c1-2-19-6-7-20(31-19)16-24-17-21-26-22(28-10-13-29-14-11-28)15-23(27-21)30-12-8-18-5-3-4-9-25-18/h3-7,9,15,17H,2,8,10-14,16H2,1H3/b24-17+ |
| InChIKey | YCUCXPKCNXSCCW-JJIBRWJFSA-N |
| XLogP | 3.57 |
| TPSA | 72.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|