C22H26N8O2 — CID 11235876
4-methyl-2-N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]benzene-1,2-diamine (PubChem CID 11235876) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-methyl-2-N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]benzene-1,2-diamine.
| Compound Name | 4-methyl-2-N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]benzene-1,2-diamine |
|---|---|
| PubChem CID | 11235876 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-methyl-2-N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]benzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(N/N=C/c2nc(OCCc3ccccn3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H26N8O2/c1-16-5-6-18(23)19(14-16)29-25-15-20-26-21(30-9-12-31-13-10-30)28-22(27-20)32-11-7-17-4-2-3-8-24-17/h2-6,8,14-15,29H,7,9-13,23H2,1H3/b25-15+ |
| InChIKey | JWNUTBQBFWMOAN-MFKUBSTISA-N |
| XLogP | 2.06 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|