C27H39N7O — CID 143341180
2-N-[(E)-[4-(dipropylamino)-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methylideneamino]-4-methylbenzene-1,2-diamine;ethane (PubChem CID 143341180) has the molecular formula C27H39N7O and a molecular weight of 477.66 g/mol. Its IUPAC name is 2-N-[(E)-[4-(dipropylamino)-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methylideneamino]-4-methylbenzene-1,2-diamine;ethane.
| Compound Name | 2-N-[(E)-[4-(dipropylamino)-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methylideneamino]-4-methylbenzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143341180 |
| Molecular Formula | C27H39N7O |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 2-N-[(E)-[4-(dipropylamino)-6-(2-pyridin-2-ylethoxy)pyrimidin-2-yl]methylideneamino]-4-methylbenzene-1,2-diamine;ethane |
| SMILES | CC.CCCN(CCC)c1cc(OCCc2ccccn2)nc(/C=N/Nc2cc(C)ccc2N)n1 |
| InChI | InChI=1S/C25H33N7O.C2H6/c1-4-13-32(14-5-2)24-17-25(33-15-11-20-8-6-7-12-27-20)30-23(29-24)18-28-31-22-16-19(3)9-10-21(22)26;1-2/h6-10,12,16-18,31H,4-5,11,13-15,26H2,1-3H3;1-2H3/b28-18+; |
| InChIKey | FVKRKKGGYHVPEB-JBQVUESZSA-N |
| XLogP | 5.48 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|