C25H33N7O — CID 143341573
ethane;N-[(E)-(3-methylphenyl)methylideneamino]-4-piperidin-1-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine (PubChem CID 143341573) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is ethane;N-[(E)-(3-methylphenyl)methylideneamino]-4-piperidin-1-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine.
| Compound Name | ethane;N-[(E)-(3-methylphenyl)methylideneamino]-4-piperidin-1-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 143341573 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | ethane;N-[(E)-(3-methylphenyl)methylideneamino]-4-piperidin-1-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine |
| SMILES | CC.Cc1cccc(/C=N/Nc2nc(OCCc3ccccn3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C23H27N7O.C2H6/c1-18-8-7-9-19(16-18)17-25-29-21-26-22(30-13-5-2-6-14-30)28-23(27-21)31-15-11-20-10-3-4-12-24-20;1-2/h3-4,7-10,12,16-17H,2,5-6,11,13-15H2,1H3,(H,26,27,28,29);1-2H3/b25-17+; |
| InChIKey | UMXURWQLVOFIIS-AREUYOMRSA-N |
| XLogP | 4.66 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|