C31H38N8O — CID 3871754
N-[[1-[2-(3-methylphenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 3871754) has the molecular formula C31H38N8O and a molecular weight of 538.70 g/mol. Its IUPAC name is N-[[1-[2-(3-methylphenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[[1-[2-(3-methylphenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3871754 |
| Molecular Formula | C31H38N8O |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | N-[[1-[2-(3-methylphenoxy)ethyl]indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(OCCn2cc(C=NNc3nc(N4CCCCC4)nc(N4CCCCC4)n3)c3ccccc32)c1 |
| InChI | InChI=1S/C31H38N8O/c1-24-11-10-12-26(21-24)40-20-19-39-23-25(27-13-4-5-14-28(27)39)22-32-36-29-33-30(37-15-6-2-7-16-37)35-31(34-29)38-17-8-3-9-18-38/h4-5,10-14,21-23H,2-3,6-9,15-20H2,1H3,(H,33,34,35,36) |
| InChIKey | OVLAPKCPGFTMSV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|