C33H36N8 — CID 126213113
N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 126213113) has the molecular formula C33H36N8 and a molecular weight of 544.71 g/mol. Its IUPAC name is N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 126213113 |
| Molecular Formula | C33H36N8 |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | C(=N/Nc1nc(N2CCCCC2)nc(N2CCCCC2)n1)\c1cn(Cc2ccc3ccccc3c2)c2ccccc12 |
| InChI | InChI=1S/C33H36N8/c1-7-17-39(18-8-1)32-35-31(36-33(37-32)40-19-9-2-10-20-40)38-34-22-28-24-41(30-14-6-5-13-29(28)30)23-25-15-16-26-11-3-4-12-27(26)21-25/h3-6,11-16,21-22,24H,1-2,7-10,17-20,23H2,(H,35,36,37,38)/b34-22+ |
| InChIKey | NABJVDLWDDXWMV-PPOKSSTKSA-N |
| XLogP | 6.45 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|