C31H39N9 — CID 71534677
4-N,4-N-diethyl-6-(4-methylpiperazin-1-yl)-2-N-[(E)-[1-[(4-prop-1-en-2-ylphenyl)methyl]indol-3-yl]methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 71534677) has the molecular formula C31H39N9 and a molecular weight of 537.72 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-(4-methylpiperazin-1-yl)-2-N-[(E)-[1-[(4-prop-1-en-2-ylphenyl)methyl]indol-3-yl]methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N,4-N-diethyl-6-(4-methylpiperazin-1-yl)-2-N-[(E)-[1-[(4-prop-1-en-2-ylphenyl)methyl]indol-3-yl]methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71534677 |
| Molecular Formula | C31H39N9 |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 4-N,4-N-diethyl-6-(4-methylpiperazin-1-yl)-2-N-[(E)-[1-[(4-prop-1-en-2-ylphenyl)methyl]indol-3-yl]methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | C=C(C)c1ccc(Cn2cc(/C=N/Nc3nc(N(CC)CC)nc(N4CCN(C)CC4)n3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H39N9/c1-6-38(7-2)30-33-29(34-31(35-30)39-18-16-37(5)17-19-39)36-32-20-26-22-40(28-11-9-8-10-27(26)28)21-24-12-14-25(15-13-24)23(3)4/h8-15,20,22H,3,6-7,16-19,21H2,1-2,4-5H3,(H,33,34,35,36)/b32-20+ |
| InChIKey | MJQIHTJBLSCCJT-UZWMFBFFSA-N |
| XLogP | 4.95 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|