C32H39N7O2 — CID 71472944
N-[(E)-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine (PubChem CID 71472944) has the molecular formula C32H39N7O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-[(E)-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[(E)-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 71472944 |
| Molecular Formula | C32H39N7O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | N-[(E)-[1-[(4-tert-butylphenyl)methyl]indol-3-yl]methylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
| SMILES | CC(C)(C)c1ccc(Cn2cc(/C=N/Nc3cc(N4CCOCC4)nc(N4CCOCC4)n3)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H39N7O2/c1-32(2,3)26-10-8-24(9-11-26)22-39-23-25(27-6-4-5-7-28(27)39)21-33-36-29-20-30(37-12-16-40-17-13-37)35-31(34-29)38-14-18-41-19-15-38/h4-11,20-21,23H,12-19,22H2,1-3H3,(H,34,35,36)/b33-21+ |
| InChIKey | IKHHMOXPEJEBBH-QNKGDIEWSA-N |
| XLogP | 4.90 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|