C29H28Cl2N6O2S — CID 70697423
2-[2-[(2E)-2-[[1-[(2,3-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]propan-2-ol (PubChem CID 70697423) has the molecular formula C29H28Cl2N6O2S and a molecular weight of 595.56 g/mol. Its IUPAC name is 2-[2-[(2E)-2-[[1-[(2,3-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]propan-2-ol.
| Compound Name | 2-[2-[(2E)-2-[[1-[(2,3-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 70697423 |
| Molecular Formula | C29H28Cl2N6O2S |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 2-[2-[(2E)-2-[[1-[(2,3-dichlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cc2nc(N/N=C/c3cn(Cc4cccc(Cl)c4Cl)c4ccccc34)nc(N3CCOCC3)c2s1 |
| InChI | InChI=1S/C29H28Cl2N6O2S/c1-29(2,38)24-14-22-26(40-24)27(36-10-12-39-13-11-36)34-28(33-22)35-32-15-19-17-37(23-9-4-3-7-20(19)23)16-18-6-5-8-21(30)25(18)31/h3-9,14-15,17,38H,10-13,16H2,1-2H3,(H,33,34,35)/b32-15+ |
| InChIKey | JBNTYLZNNSGBES-VWJSQJICSA-N |
| XLogP | 6.51 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|