C19H23BrN6O3 — CID 2852856
4-bromo-2-[[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 2852856) has the molecular formula C19H23BrN6O3 and a molecular weight of 463.34 g/mol. Its IUPAC name is 4-bromo-2-[[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 2852856 |
| Molecular Formula | C19H23BrN6O3 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-bromo-2-[[(2,6-dimorpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1C=NNc1cc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H23BrN6O3/c20-15-1-2-16(27)14(11-15)13-21-24-17-12-18(25-3-7-28-8-4-25)23-19(22-17)26-5-9-29-10-6-26/h1-2,11-13,27H,3-10H2,(H,22,23,24) |
| InChIKey | CFHYLHCTFIHLKB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|