C23H29N5 — CID 143341789
ethane;N-[(E)-(3-methylphenyl)methylideneamino]-2-piperidin-1-ylquinazolin-4-amine (PubChem CID 143341789) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is ethane;N-[(E)-(3-methylphenyl)methylideneamino]-2-piperidin-1-ylquinazolin-4-amine.
| Compound Name | ethane;N-[(E)-(3-methylphenyl)methylideneamino]-2-piperidin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 143341789 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | ethane;N-[(E)-(3-methylphenyl)methylideneamino]-2-piperidin-1-ylquinazolin-4-amine |
| SMILES | CC.Cc1cccc(/C=N/Nc2nc(N3CCCCC3)nc3ccccc23)c1 |
| InChI | InChI=1S/C21H23N5.C2H6/c1-16-8-7-9-17(14-16)15-22-25-20-18-10-3-4-11-19(18)23-21(24-20)26-12-5-2-6-13-26;1-2/h3-4,7-11,14-15H,2,5-6,12-13H2,1H3,(H,23,24,25);1-2H3/b22-15+; |
| InChIKey | FMTHLHYWZMOUIB-WXXHTBLMSA-N |
| XLogP | 5.40 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|