C21H22N8OS — CID 170724779
N-[(E)-(3-methylphenyl)methylideneamino]-9-(3-methyl-1,2-thiazol-5-yl)-2-morpholin-4-ylpurin-6-amine (PubChem CID 170724779) has the molecular formula C21H22N8OS and a molecular weight of 434.53 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-9-(3-methyl-1,2-thiazol-5-yl)-2-morpholin-4-ylpurin-6-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-9-(3-methyl-1,2-thiazol-5-yl)-2-morpholin-4-ylpurin-6-amine |
|---|---|
| PubChem CID | 170724779 |
| Molecular Formula | C21H22N8OS |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-9-(3-methyl-1,2-thiazol-5-yl)-2-morpholin-4-ylpurin-6-amine |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)nc3c2ncn3-c2cc(C)ns2)c1 |
| InChI | InChI=1S/C21H22N8OS/c1-14-4-3-5-16(10-14)12-23-26-19-18-20(25-21(24-19)28-6-8-30-9-7-28)29(13-22-18)17-11-15(2)27-31-17/h3-5,10-13H,6-9H2,1-2H3,(H,24,25,26)/b23-12+ |
| InChIKey | BMCOJQNEUJTEFU-FSJBWODESA-N |
| XLogP | 3.17 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|