C24H22F3N7O — CID 170724712
N-[(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-9-[4-(trifluoromethyl)phenyl]purin-6-amine (PubChem CID 170724712) has the molecular formula C24H22F3N7O and a molecular weight of 481.48 g/mol. Its IUPAC name is N-[(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-9-[4-(trifluoromethyl)phenyl]purin-6-amine.
| Compound Name | N-[(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-9-[4-(trifluoromethyl)phenyl]purin-6-amine |
|---|---|
| PubChem CID | 170724712 |
| Molecular Formula | C24H22F3N7O |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[(3-methylphenyl)methylideneamino]-2-morpholin-4-yl-9-[4-(trifluoromethyl)phenyl]purin-6-amine |
| SMILES | Cc1cccc(C=NNc2nc(N3CCOCC3)nc3c2ncn3-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H22F3N7O/c1-16-3-2-4-17(13-16)14-29-32-21-20-22(31-23(30-21)33-9-11-35-12-10-33)34(15-28-20)19-7-5-18(6-8-19)24(25,26)27/h2-8,13-15H,9-12H2,1H3,(H,30,31,32) |
| InChIKey | WMBUVNIVDKMCII-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|