C25H33N9O2 — CID 175967256
N,N-dimethyl-4-[6-[2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]piperidine-1-carboxamide (PubChem CID 175967256) has the molecular formula C25H33N9O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is N,N-dimethyl-4-[6-[2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]piperidine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[6-[2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 175967256 |
| Molecular Formula | C25H33N9O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | N,N-dimethyl-4-[6-[2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]piperidine-1-carboxamide |
| SMILES | Cc1cccc(C=NNc2nc(N3CCOCC3)nc3c2ncn3C2CCN(C(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C25H33N9O2/c1-18-5-4-6-19(15-18)16-27-30-22-21-23(29-24(28-22)32-11-13-36-14-12-32)34(17-26-21)20-7-9-33(10-8-20)25(35)31(2)3/h4-6,15-17,20H,7-14H2,1-3H3,(H,28,29,30) |
| InChIKey | GJKZYWZLILQNJO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|