C22H22N8O2 — CID 170724540
4-[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]-1H-pyridin-2-one (PubChem CID 170724540) has the molecular formula C22H22N8O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]-1H-pyridin-2-one.
| Compound Name | 4-[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170724540 |
| Molecular Formula | C22H22N8O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[6-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]-2-morpholin-4-ylpurin-9-yl]-1H-pyridin-2-one |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)nc3c2ncn3-c2cc[nH]c(=O)c2)c1 |
| InChI | InChI=1S/C22H22N8O2/c1-15-3-2-4-16(11-15)13-25-28-20-19-21(27-22(26-20)29-7-9-32-10-8-29)30(14-24-19)17-5-6-23-18(31)12-17/h2-6,11-14H,7-10H2,1H3,(H,23,31)(H,26,27,28)/b25-13+ |
| InChIKey | PQBHNCKINKJNKR-DHRITJCHSA-N |
| XLogP | 2.09 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|