C22H24N8O — CID 172568867
3-methyl-N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-(1H-pyrazol-4-yl)imidazo[4,5-b]pyridin-5-amine (PubChem CID 172568867) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 3-methyl-N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-(1H-pyrazol-4-yl)imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 3-methyl-N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-(1H-pyrazol-4-yl)imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 172568867 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-methyl-N-[(E)-(3-methylphenyl)methylideneamino]-7-morpholin-4-yl-2-(1H-pyrazol-4-yl)imidazo[4,5-b]pyridin-5-amine |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCOCC3)c3nc(-c4cn[nH]c4)n(C)c3n2)c1 |
| InChI | InChI=1S/C22H24N8O/c1-15-4-3-5-16(10-15)12-25-28-19-11-18(30-6-8-31-9-7-30)20-22(26-19)29(2)21(27-20)17-13-23-24-14-17/h3-5,10-14H,6-9H2,1-2H3,(H,23,24)(H,26,28)/b25-12+ |
| InChIKey | ACZIPHUUZFWXRV-BRJLIKDPSA-N |
| XLogP | 2.95 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|