C28H28N8O — CID 70922163
N-[(3-methylphenyl)methylideneamino]-2-(5-methyl-1-phenylpyrazol-4-yl)-8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-amine (PubChem CID 70922163) has the molecular formula C28H28N8O and a molecular weight of 492.59 g/mol. Its IUPAC name is N-[(3-methylphenyl)methylideneamino]-2-(5-methyl-1-phenylpyrazol-4-yl)-8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-[(3-methylphenyl)methylideneamino]-2-(5-methyl-1-phenylpyrazol-4-yl)-8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 70922163 |
| Molecular Formula | C28H28N8O |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-[(3-methylphenyl)methylideneamino]-2-(5-methyl-1-phenylpyrazol-4-yl)-8-morpholin-4-ylimidazo[1,2-b]pyridazin-6-amine |
| SMILES | Cc1cccc(C=NNc2cc(N3CCOCC3)c3nc(-c4cnn(-c5ccccc5)c4C)cn3n2)c1 |
| InChI | InChI=1S/C28H28N8O/c1-20-7-6-8-22(15-20)17-29-32-27-16-26(34-11-13-37-14-12-34)28-31-25(19-35(28)33-27)24-18-30-36(21(24)2)23-9-4-3-5-10-23/h3-10,15-19H,11-14H2,1-2H3,(H,32,33) |
| InChIKey | OIVQSBYOJLHLAY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|