C24H24N6O — CID 161314450
1-(3-methylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine (PubChem CID 161314450) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine.
| Compound Name | 1-(3-methylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine |
|---|---|
| PubChem CID | 161314450 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-(3-methylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine |
| SMILES | Cc1cccc(/C=N/Cc2cc(N3CCOCC3)c3nc(-c4ccncc4)cn3n2)c1 |
| InChI | InChI=1S/C24H24N6O/c1-18-3-2-4-19(13-18)15-26-16-21-14-23(29-9-11-31-12-10-29)24-27-22(17-30(24)28-21)20-5-7-25-8-6-20/h2-8,13-15,17H,9-12,16H2,1H3/b26-15+ |
| InChIKey | VJHVOBMPWGTVPU-CVKSISIWSA-N |
| XLogP | 3.56 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|