C23H23N7O — CID 123360720
(3-methylphenyl)methyl-(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)diazene (PubChem CID 123360720) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is (3-methylphenyl)methyl-(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)diazene.
| Compound Name | (3-methylphenyl)methyl-(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)diazene |
|---|---|
| PubChem CID | 123360720 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (3-methylphenyl)methyl-(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)diazene |
| SMILES | Cc1cccc(C/N=N/c2cc(N3CCOCC3)c3nc(-c4ccncc4)cn3n2)c1 |
| InChI | InChI=1S/C23H23N7O/c1-17-3-2-4-18(13-17)15-25-27-22-14-21(29-9-11-31-12-10-29)23-26-20(16-30(23)28-22)19-5-7-24-8-6-19/h2-8,13-14,16H,9-12,15H2,1H3/b27-25+ |
| InChIKey | ZMSXMPYFKJZAGN-IMVLJIQESA-N |
| XLogP | 4.22 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|