C25H24N6O — CID 158279619
1-(3-ethenylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine (PubChem CID 158279619) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-(3-ethenylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine.
| Compound Name | 1-(3-ethenylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine |
|---|---|
| PubChem CID | 158279619 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-(3-ethenylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine |
| SMILES | C=Cc1cccc(/C=N/Cc2cc(N3CCOCC3)c3nc(-c4ccncc4)cn3n2)c1 |
| InChI | InChI=1S/C25H24N6O/c1-2-19-4-3-5-20(14-19)16-27-17-22-15-24(30-10-12-32-13-11-30)25-28-23(18-31(25)29-22)21-6-8-26-9-7-21/h2-9,14-16,18H,1,10-13,17H2/b27-16+ |
| InChIKey | GKAZPCVTSCLYOC-JVWAILMASA-N |
| XLogP | 3.89 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|