C29H34N6O — CID 159116567
1-(3-hexan-2-ylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine (PubChem CID 159116567) has the molecular formula C29H34N6O and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-(3-hexan-2-ylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine.
| Compound Name | 1-(3-hexan-2-ylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine |
|---|---|
| PubChem CID | 159116567 |
| Molecular Formula | C29H34N6O |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 1-(3-hexan-2-ylphenyl)-N-[(8-morpholin-4-yl-2-pyridin-4-ylimidazo[1,2-b]pyridazin-6-yl)methyl]methanimine |
| SMILES | CCCCC(C)c1cccc(/C=N/Cc2cc(N3CCOCC3)c3nc(-c4ccncc4)cn3n2)c1 |
| InChI | InChI=1S/C29H34N6O/c1-3-4-6-22(2)25-8-5-7-23(17-25)19-31-20-26-18-28(34-13-15-36-16-14-34)29-32-27(21-35(29)33-26)24-9-11-30-12-10-24/h5,7-12,17-19,21-22H,3-4,6,13-16,20H2,1-2H3/b31-19+ |
| InChIKey | KFDZTJGHRCMXDA-ZCTHSVRISA-N |
| XLogP | 5.54 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|