C23H22N6O — CID 123256118
benzyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene (PubChem CID 123256118) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is benzyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene.
| Compound Name | benzyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
|---|---|
| PubChem CID | 123256118 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | benzyl-(7-morpholin-4-yl-2-phenylpyrazolo[1,5-a]pyrimidin-5-yl)diazene |
| SMILES | c1ccc(C/N=N/c2cc(N3CCOCC3)n3nc(-c4ccccc4)cc3n2)cc1 |
| InChI | InChI=1S/C23H22N6O/c1-3-7-18(8-4-1)17-24-26-21-16-23(28-11-13-30-14-12-28)29-22(25-21)15-20(27-29)19-9-5-2-6-10-19/h1-10,15-16H,11-14,17H2/b26-24+ |
| InChIKey | ISSYXRIPOIIWDP-SHHOIMCASA-N |
| XLogP | 4.52 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|