C21H25N5O2 — CID 91056793
4-[[6-[(3-methylphenyl)methyldiazenyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanenitrile (PubChem CID 91056793) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[[6-[(3-methylphenyl)methyldiazenyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanenitrile.
| Compound Name | 4-[[6-[(3-methylphenyl)methyldiazenyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanenitrile |
|---|---|
| PubChem CID | 91056793 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-[[6-[(3-methylphenyl)methyldiazenyl]-4-morpholin-4-yl-2-pyridinyl]oxy]butanenitrile |
| SMILES | Cc1cccc(C/N=N/c2cc(N3CCOCC3)cc(OCCCC#N)n2)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-17-5-4-6-18(13-17)16-23-25-20-14-19(26-8-11-27-12-9-26)15-21(24-20)28-10-3-2-7-22/h4-6,13-15H,2-3,8-12,16H2,1H3/b25-23+ |
| InChIKey | GQOMHQHOOGAGPH-WJTDDFOZSA-N |
| XLogP | 4.19 |
| TPSA | 83.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|