C26H34N6O4 — CID 91426337
N-cyclopropyl-3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzamide (PubChem CID 91426337) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-cyclopropyl-3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzamide.
| Compound Name | N-cyclopropyl-3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzamide |
|---|---|
| PubChem CID | 91426337 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-cyclopropyl-3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(C/N=N/c2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C26H34N6O4/c33-26(28-22-4-5-22)21-3-1-2-20(16-21)19-27-30-24-17-23(32-9-13-35-14-10-32)18-25(29-24)36-15-8-31-6-11-34-12-7-31/h1-3,16-18,22H,4-15,19H2,(H,28,33)/b30-27+ |
| InChIKey | CEMQUBLWXJLDJV-KDJFERLWSA-N |
| XLogP | 2.81 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|