C26H35N5O5 — CID 91167856
propan-2-yl 3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzoate (PubChem CID 91167856) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is propan-2-yl 3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzoate.
| Compound Name | propan-2-yl 3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzoate |
|---|---|
| PubChem CID | 91167856 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | propan-2-yl 3-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazenyl]methyl]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(C/N=N/c2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C26H35N5O5/c1-20(2)36-26(32)22-5-3-4-21(16-22)19-27-29-24-17-23(31-9-13-34-14-10-31)18-25(28-24)35-15-8-30-6-11-33-12-7-30/h3-5,16-18,20H,6-15,19H2,1-2H3/b29-27+ |
| InChIKey | YQFYBBXIYYOIKS-ORIPQNMZSA-N |
| XLogP | 3.48 |
| TPSA | 98.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|