C26H36N6O2 — CID 91248171
[6-[2-(4-ethyl-3-methylidenepiperazin-1-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene (PubChem CID 91248171) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is [6-[2-(4-ethyl-3-methylidenepiperazin-1-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene.
| Compound Name | [6-[2-(4-ethyl-3-methylidenepiperazin-1-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene |
|---|---|
| PubChem CID | 91248171 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [6-[2-(4-ethyl-3-methylidenepiperazin-1-yl)ethoxy]-4-morpholin-4-yl-2-pyridinyl]-[(3-methylphenyl)methyl]diazene |
| SMILES | C=C1CN(CCOc2cc(N3CCOCC3)cc(/N=N/Cc3cccc(C)c3)n2)CCN1CC |
| InChI | InChI=1S/C26H36N6O2/c1-4-31-9-8-30(20-22(31)3)10-15-34-26-18-24(32-11-13-33-14-12-32)17-25(28-26)29-27-19-23-7-5-6-21(2)16-23/h5-7,16-18H,3-4,8-15,19-20H2,1-2H3/b29-27+ |
| InChIKey | POCRDRBTSYZBFH-ORIPQNMZSA-N |
| XLogP | 4.04 |
| TPSA | 65.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|