C23H29F2N5O3 — CID 91388459
[3,5-difluoro-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]-[(3-methylphenyl)methyl]diazene (PubChem CID 91388459) has the molecular formula C23H29F2N5O3 and a molecular weight of 461.51 g/mol. Its IUPAC name is [3,5-difluoro-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]-[(3-methylphenyl)methyl]diazene.
| Compound Name | [3,5-difluoro-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]-[(3-methylphenyl)methyl]diazene |
|---|---|
| PubChem CID | 91388459 |
| Molecular Formula | C23H29F2N5O3 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [3,5-difluoro-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]-[(3-methylphenyl)methyl]diazene |
| SMILES | Cc1cccc(C/N=N/c2nc(OCCN3CCOCC3)c(F)c(N3CCOCC3)c2F)c1 |
| InChI | InChI=1S/C23H29F2N5O3/c1-17-3-2-4-18(15-17)16-26-28-22-19(24)21(30-8-12-32-13-9-30)20(25)23(27-22)33-14-7-29-5-10-31-11-6-29/h2-4,15H,5-14,16H2,1H3/b28-26+ |
| InChIKey | YITODOSEYDKNAD-BYCLXTJYSA-N |
| XLogP | 3.50 |
| TPSA | 71.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|