C21H31N7O2 — CID 91298050
N,N-diethyl-4-[(3-methylphenyl)methyldiazenyl]-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-amine (PubChem CID 91298050) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-methylphenyl)methyldiazenyl]-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-[(3-methylphenyl)methyldiazenyl]-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 91298050 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N,N-diethyl-4-[(3-methylphenyl)methyldiazenyl]-6-(2-morpholin-4-ylethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(/N=N/Cc2cccc(C)c2)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C21H31N7O2/c1-4-28(5-2)20-23-19(26-22-16-18-8-6-7-17(3)15-18)24-21(25-20)30-14-11-27-9-12-29-13-10-27/h6-8,15H,4-5,9-14,16H2,1-3H3/b26-22+ |
| InChIKey | GZQJPBWDGAWCMM-XTCLZLMSSA-N |
| XLogP | 3.02 |
| TPSA | 88.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|