C26H30N6O4 — CID 91376685
2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl N-(4-methylphenyl)carbamate (PubChem CID 91376685) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl N-(4-methylphenyl)carbamate.
| Compound Name | 2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 91376685 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCCOc2nc(/N=N/Cc3cccc(C)c3)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C26H30N6O4/c1-19-6-8-22(9-7-19)28-26(33)36-15-14-35-25-29-23(17-24(30-25)32-10-12-34-13-11-32)31-27-18-21-5-3-4-20(2)16-21/h3-9,16-17H,10-15,18H2,1-2H3,(H,28,33)/b31-27+ |
| InChIKey | CEQLQUQHJXRROU-TVKQRKNISA-N |
| XLogP | 4.84 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|