C26H29N7O5 — CID 90751088
3-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]propyl N-(4-nitrophenyl)carbamate (PubChem CID 90751088) has the molecular formula C26H29N7O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is 3-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]propyl N-(4-nitrophenyl)carbamate.
| Compound Name | 3-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]propyl N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 90751088 |
| Molecular Formula | C26H29N7O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 3-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]propyl N-(4-nitrophenyl)carbamate |
| SMILES | Cc1cccc(C/N=N/c2cc(N3CCOCC3)nc(CCCOC(=O)Nc3ccc([N+](=O)[O-])cc3)n2)c1 |
| InChI | InChI=1S/C26H29N7O5/c1-19-4-2-5-20(16-19)18-27-31-24-17-25(32-11-14-37-15-12-32)30-23(29-24)6-3-13-38-26(34)28-21-7-9-22(10-8-21)33(35)36/h2,4-5,7-10,16-17H,3,6,11-15,18H2,1H3,(H,28,34)/b31-27+ |
| InChIKey | FANSCJHUSHEGGA-TVKQRKNISA-N |
| XLogP | 5.00 |
| TPSA | 144.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|