C22H22N6O5 — CID 141446829
(4-nitrophenyl) N-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]carbamate (PubChem CID 141446829) has the molecular formula C22H22N6O5 and a molecular weight of 450.46 g/mol. Its IUPAC name is (4-nitrophenyl) N-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 141446829 |
| Molecular Formula | C22H22N6O5 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (4-nitrophenyl) N-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]carbamate |
| SMILES | Cc1nc(Nc2cccc(NC(=O)Oc3ccc([N+](=O)[O-])cc3)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H22N6O5/c1-15-23-20(14-21(24-15)27-9-11-32-12-10-27)25-16-3-2-4-17(13-16)26-22(29)33-19-7-5-18(6-8-19)28(30)31/h2-8,13-14H,9-12H2,1H3,(H,26,29)(H,23,24,25) |
| InChIKey | BPDCGJQKVBELBT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|