C22H30N6O2 — CID 70674637
1-cyclohexyl-3-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea (PubChem CID 70674637) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea.
| Compound Name | 1-cyclohexyl-3-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 70674637 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 1-cyclohexyl-3-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea |
| SMILES | Cc1nc(Nc2cccc(NC(=O)NC3CCCCC3)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H30N6O2/c1-16-23-20(15-21(24-16)28-10-12-30-13-11-28)25-18-8-5-9-19(14-18)27-22(29)26-17-6-3-2-4-7-17/h5,8-9,14-15,17H,2-4,6-7,10-13H2,1H3,(H,23,24,25)(H2,26,27,29) |
| InChIKey | GBGVQNOYFNWQIO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |