C24H35N7O2 — CID 70674867
1-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-3-(4-pyrrolidin-1-ylbutyl)urea (PubChem CID 70674867) has the molecular formula C24H35N7O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-3-(4-pyrrolidin-1-ylbutyl)urea.
| Compound Name | 1-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-3-(4-pyrrolidin-1-ylbutyl)urea |
|---|---|
| PubChem CID | 70674867 |
| Molecular Formula | C24H35N7O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 1-[3-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]-3-(4-pyrrolidin-1-ylbutyl)urea |
| SMILES | Cc1nc(Nc2cccc(NC(=O)NCCCCN3CCCC3)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H35N7O2/c1-19-26-22(18-23(27-19)31-13-15-33-16-14-31)28-20-7-6-8-21(17-20)29-24(32)25-9-2-3-10-30-11-4-5-12-30/h6-8,17-18H,2-5,9-16H2,1H3,(H2,25,29,32)(H,26,27,28) |
| InChIKey | UBZNDSILJABEKY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|