C22H23FN6O2 — CID 50748155
1-(2-fluorophenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea (PubChem CID 50748155) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 50748155 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]urea |
| SMILES | Cc1nc(Nc2ccc(NC(=O)Nc3ccccc3F)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H23FN6O2/c1-15-24-20(14-21(25-15)29-10-12-31-13-11-29)26-16-6-8-17(9-7-16)27-22(30)28-19-5-3-2-4-18(19)23/h2-9,14H,10-13H2,1H3,(H,24,25,26)(H2,27,28,30) |
| InChIKey | AHTMMTQJBCGGEB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |