C23H24FN5O2 — CID 122297275
2-(4-fluorophenyl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]acetamide (PubChem CID 122297275) has the molecular formula C23H24FN5O2 and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122297275 |
| Molecular Formula | C23H24FN5O2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]phenyl]acetamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)Cc3ccc(F)cc3)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H24FN5O2/c1-16-25-21(15-22(26-16)29-10-12-31-13-11-29)27-19-6-8-20(9-7-19)28-23(30)14-17-2-4-18(24)5-3-17/h2-9,15H,10-14H2,1H3,(H,28,30)(H,25,26,27) |
| InChIKey | KMHPPVXYXVLNHM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |