C26H29N9O2 — CID 90880187
1-cyano-2-[2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-3-phenylguanidine (PubChem CID 90880187) has the molecular formula C26H29N9O2 and a molecular weight of 499.58 g/mol. Its IUPAC name is 1-cyano-2-[2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-3-phenylguanidine.
| Compound Name | 1-cyano-2-[2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-3-phenylguanidine |
|---|---|
| PubChem CID | 90880187 |
| Molecular Formula | C26H29N9O2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 1-cyano-2-[2-[4-[(3-methylphenyl)methyldiazenyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-3-phenylguanidine |
| SMILES | Cc1cccc(C/N=N/c2cc(N3CCOCC3)nc(OCC/N=C(\NC#N)Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C26H29N9O2/c1-20-6-5-7-21(16-20)18-30-34-23-17-24(35-11-14-36-15-12-35)33-26(32-23)37-13-10-28-25(29-19-27)31-22-8-3-2-4-9-22/h2-9,16-17H,10-15,18H2,1H3,(H2,28,29,31)/b34-30+ |
| InChIKey | PZYJQLWSKJFFDJ-VBMGMRCRSA-N |
| XLogP | 3.82 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|