C27H32N4O4 — CID 91383917
[2-[2-(2,3-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]-[(3-methylphenyl)methyl]diazene (PubChem CID 91383917) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is [2-[2-(2,3-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]-[(3-methylphenyl)methyl]diazene.
| Compound Name | [2-[2-(2,3-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]-[(3-methylphenyl)methyl]diazene |
|---|---|
| PubChem CID | 91383917 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [2-[2-(2,3-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]-[(3-methylphenyl)methyl]diazene |
| SMILES | COc1cccc(CCOc2cc(/N=N/Cc3cccc(C)c3)cc(N3CCOCC3)n2)c1OC |
| InChI | InChI=1S/C27H32N4O4/c1-20-6-4-7-21(16-20)19-28-30-23-17-25(31-11-14-34-15-12-31)29-26(18-23)35-13-10-22-8-5-9-24(32-2)27(22)33-3/h4-9,16-18H,10-15,19H2,1-3H3/b30-28+ |
| InChIKey | FWCVURRYJLYHSN-SJCQXOIGSA-N |
| XLogP | 5.15 |
| TPSA | 77.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|