C28H33N3O4 — CID 58060423
N-[[2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]methyl]-1-(3-methylphenyl)methanimine (PubChem CID 58060423) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[[2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]methyl]-1-(3-methylphenyl)methanimine.
| Compound Name | N-[[2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]methyl]-1-(3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 58060423 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[[2-[2-(3,4-dimethoxyphenyl)ethoxy]-6-morpholin-4-yl-4-pyridinyl]methyl]-1-(3-methylphenyl)methanimine |
| SMILES | COc1ccc(CCOc2cc(C/N=C/c3cccc(C)c3)cc(N3CCOCC3)n2)cc1OC |
| InChI | InChI=1S/C28H33N3O4/c1-21-5-4-6-23(15-21)19-29-20-24-17-27(31-10-13-34-14-11-31)30-28(18-24)35-12-9-22-7-8-25(32-2)26(16-22)33-3/h4-8,15-19H,9-14,20H2,1-3H3/b29-19+ |
| InChIKey | MVUGCMLXPMWSLG-VUTHCHCSSA-N |
| XLogP | 4.48 |
| TPSA | 65.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|