C24H32N4O4 — CID 58060217
1-(3-methylphenyl)-N-[[4-morpholin-4-yl-6-[2-(4-oxidomorpholin-4-ium-4-yl)ethoxy]-2-pyridinyl]methyl]methanimine (PubChem CID 58060217) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[[4-morpholin-4-yl-6-[2-(4-oxidomorpholin-4-ium-4-yl)ethoxy]-2-pyridinyl]methyl]methanimine.
| Compound Name | 1-(3-methylphenyl)-N-[[4-morpholin-4-yl-6-[2-(4-oxidomorpholin-4-ium-4-yl)ethoxy]-2-pyridinyl]methyl]methanimine |
|---|---|
| PubChem CID | 58060217 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-(3-methylphenyl)-N-[[4-morpholin-4-yl-6-[2-(4-oxidomorpholin-4-ium-4-yl)ethoxy]-2-pyridinyl]methyl]methanimine |
| SMILES | Cc1cccc(/C=N/Cc2cc(N3CCOCC3)cc(OCC[N+]3([O-])CCOCC3)n2)c1 |
| InChI | InChI=1S/C24H32N4O4/c1-20-3-2-4-21(15-20)18-25-19-22-16-23(27-5-10-30-11-6-27)17-24(26-22)32-14-9-28(29)7-12-31-13-8-28/h2-4,15-18H,5-14,19H2,1H3/b25-18+ |
| InChIKey | WOTWQFVBLIDAKX-XIEYBQDHSA-N |
| XLogP | 2.57 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|