C25H36N6O2 — CID 58060487
2-methyl-1-[2-[[6-[[(3-methylphenyl)methylideneamino]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-3-propylguanidine (PubChem CID 58060487) has the molecular formula C25H36N6O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-methyl-1-[2-[[6-[[(3-methylphenyl)methylideneamino]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-3-propylguanidine.
| Compound Name | 2-methyl-1-[2-[[6-[[(3-methylphenyl)methylideneamino]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-3-propylguanidine |
|---|---|
| PubChem CID | 58060487 |
| Molecular Formula | C25H36N6O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 2-methyl-1-[2-[[6-[[(3-methylphenyl)methylideneamino]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-3-propylguanidine |
| SMILES | CCCN/C(=N\C)NCCOc1cc(N2CCOCC2)cc(C/N=C/c2cccc(C)c2)n1 |
| InChI | InChI=1S/C25H36N6O2/c1-4-8-28-25(26-3)29-9-12-33-24-17-23(31-10-13-32-14-11-31)16-22(30-24)19-27-18-21-7-5-6-20(2)15-21/h5-7,15-18H,4,8-14,19H2,1-3H3,(H2,26,28,29)/b27-18+ |
| InChIKey | JQFGKEYAKKRMIN-OVVQPSECSA-N |
| XLogP | 2.80 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|