C28H36N4O7S — CID 16662174
4-[2-(3,4-dimethoxyphenyl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-ylpyridin-2-amine;methanesulfonic acid (PubChem CID 16662174) has the molecular formula C28H36N4O7S and a molecular weight of 572.68 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-ylpyridin-2-amine;methanesulfonic acid.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-ylpyridin-2-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 16662174 |
| Molecular Formula | C28H36N4O7S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethoxy]-N-[(E)-(3-methylphenyl)methylideneamino]-6-morpholin-4-ylpyridin-2-amine;methanesulfonic acid |
| SMILES | COc1ccc(CCOc2cc(N/N=C/c3cccc(C)c3)nc(N3CCOCC3)c2)cc1OC.CS(=O)(=O)O |
| InChI | InChI=1S/C27H32N4O4.CH4O3S/c1-20-5-4-6-22(15-20)19-28-30-26-17-23(18-27(29-26)31-10-13-34-14-11-31)35-12-9-21-7-8-24(32-2)25(16-21)33-3;1-5(2,3)4/h4-8,15-19H,9-14H2,1-3H3,(H,29,30);1H3,(H,2,3,4)/b28-19+; |
| InChIKey | WLBGTTCLAYBNRP-SOQZJLQASA-N |
| XLogP | 3.82 |
| TPSA | 131.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|