C20H27N5O4 — CID 90828738
furan-3-ylmethyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene (PubChem CID 90828738) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is furan-3-ylmethyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene.
| Compound Name | furan-3-ylmethyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene |
|---|---|
| PubChem CID | 90828738 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | furan-3-ylmethyl-[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]diazene |
| SMILES | c1cc(C/N=N/c2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)co1 |
| InChI | InChI=1S/C20H27N5O4/c1-7-28-16-17(1)15-21-23-19-13-18(25-5-10-27-11-6-25)14-20(22-19)29-12-4-24-2-8-26-9-3-24/h1,7,13-14,16H,2-6,8-12,15H2/b23-21+ |
| InChIKey | XRRQVHNCXGSIPE-XTQSDGFTSA-N |
| XLogP | 2.51 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|