C24H32N6O5 — CID 66684026
3-(hydroxymethyl)-5-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]hydrazinylidene]methyl]benzamide (PubChem CID 66684026) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]hydrazinylidene]methyl]benzamide.
| Compound Name | 3-(hydroxymethyl)-5-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]hydrazinylidene]methyl]benzamide |
|---|---|
| PubChem CID | 66684026 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 3-(hydroxymethyl)-5-[[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]hydrazinylidene]methyl]benzamide |
| SMILES | NC(=O)c1cc(C=NNc2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)cc(CO)c1 |
| InChI | InChI=1S/C24H32N6O5/c25-24(32)20-12-18(11-19(13-20)17-31)16-26-28-22-14-21(30-4-8-34-9-5-30)15-23(27-22)35-10-3-29-1-6-33-7-2-29/h11-16,31H,1-10,17H2,(H2,25,32)(H,27,28) |
| InChIKey | GANDNYLDDIJMDK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|