C23H28N6O4 — CID 66682175
N-(1,2-benzoxazol-3-ylmethylideneamino)-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine (PubChem CID 66682175) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-ylmethylideneamino)-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine.
| Compound Name | N-(1,2-benzoxazol-3-ylmethylideneamino)-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 66682175 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-(1,2-benzoxazol-3-ylmethylideneamino)-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
| SMILES | C(=NNc1cc(N2CCOCC2)cc(OCCN2CCOCC2)n1)c1noc2ccccc12 |
| InChI | InChI=1S/C23H28N6O4/c1-2-4-21-19(3-1)20(27-33-21)17-24-26-22-15-18(29-8-12-31-13-9-29)16-23(25-22)32-14-7-28-5-10-30-11-6-28/h1-4,15-17H,5-14H2,(H,25,26) |
| InChIKey | QPEDIELXQYDSCO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|