C24H29N5O4 — CID 59673886
N-[(E)-1-benzofuran-3-ylmethylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine (PubChem CID 59673886) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[(E)-1-benzofuran-3-ylmethylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine.
| Compound Name | N-[(E)-1-benzofuran-3-ylmethylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 59673886 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-[(E)-1-benzofuran-3-ylmethylideneamino]-2-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-4-amine |
| SMILES | C(=N/Nc1cc(OCCN2CCOCC2)nc(N2CCOCC2)c1)\c1coc2ccccc12 |
| InChI | InChI=1S/C24H29N5O4/c1-2-4-22-21(3-1)19(18-33-22)17-25-27-20-15-23(29-8-12-31-13-9-29)26-24(16-20)32-14-7-28-5-10-30-11-6-28/h1-4,15-18H,5-14H2,(H,26,27)/b25-17+ |
| InChIKey | DCYQNXAQBBFUIH-KOEQRZSOSA-N |
| XLogP | 2.82 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|