C21H30N6O3S — CID 66648274
5-ethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]methylideneamino]thiophen-2-amine (PubChem CID 66648274) has the molecular formula C21H30N6O3S and a molecular weight of 446.58 g/mol. Its IUPAC name is 5-ethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]methylideneamino]thiophen-2-amine.
| Compound Name | 5-ethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]methylideneamino]thiophen-2-amine |
|---|---|
| PubChem CID | 66648274 |
| Molecular Formula | C21H30N6O3S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 5-ethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyrimidin-2-yl]methylideneamino]thiophen-2-amine |
| SMILES | CCc1ccc(NN=Cc2nc(OCCN3CCOCC3)cc(N3CCOCC3)n2)s1 |
| InChI | InChI=1S/C21H30N6O3S/c1-2-17-3-4-21(31-17)25-22-16-18-23-19(27-8-12-29-13-9-27)15-20(24-18)30-14-7-26-5-10-28-11-6-26/h3-4,15-16,25H,2,5-14H2,1H3 |
| InChIKey | UUTCERJDCMEDFT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|