C23H27N5O2S — CID 58655454
N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-6-(2-morpholin-4-ylethoxy)-4-pyridin-4-ylpyridin-2-amine (PubChem CID 58655454) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-6-(2-morpholin-4-ylethoxy)-4-pyridin-4-ylpyridin-2-amine.
| Compound Name | N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-6-(2-morpholin-4-ylethoxy)-4-pyridin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 58655454 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-6-(2-morpholin-4-ylethoxy)-4-pyridin-4-ylpyridin-2-amine |
| SMILES | Cc1cc(/C=N/Nc2cc(-c3ccncc3)cc(OCCN3CCOCC3)n2)sc1C |
| InChI | InChI=1S/C23H27N5O2S/c1-17-13-21(31-18(17)2)16-25-27-22-14-20(19-3-5-24-6-4-19)15-23(26-22)30-12-9-28-7-10-29-11-8-28/h3-6,13-16H,7-12H2,1-2H3,(H,26,27)/b25-16+ |
| InChIKey | HUSPZYGNSCOEEW-PCLIKHOPSA-N |
| XLogP | 3.98 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|